C15H18ClN5O2S — CID 46640350
N-(4-chlorophenyl)-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 46640350) has the molecular formula C15H18ClN5O2S and a molecular weight of 367.86 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-(4-chlorophenyl)-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 46640350 |
| Molecular Formula | C15H18ClN5O2S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-(4-chlorophenyl)-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nnnn1CC1CCCO1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H18ClN5O2S/c1-10(14(22)17-12-6-4-11(16)5-7-12)24-15-18-19-20-21(15)9-13-3-2-8-23-13/h4-7,10,13H,2-3,8-9H2,1H3,(H,17,22) |
| InChIKey | IWQAOLVFLURJMB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |