C16H20ClN5O2S — CID 51259247
N-[(4-chlorophenyl)methyl]-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 51259247) has the molecular formula C16H20ClN5O2S and a molecular weight of 381.89 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 51259247 |
| Molecular Formula | C16H20ClN5O2S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nnnn1CC1CCCO1)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClN5O2S/c1-11(15(23)18-9-12-4-6-13(17)7-5-12)25-16-19-20-21-22(16)10-14-3-2-8-24-14/h4-7,11,14H,2-3,8-10H2,1H3,(H,18,23) |
| InChIKey | OCFCRACPNNIHCU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |