C15H17BrFN5O2S — CID 46640552
N-(4-bromo-2-fluorophenyl)-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 46640552) has the molecular formula C15H17BrFN5O2S and a molecular weight of 430.30 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 46640552 |
| Molecular Formula | C15H17BrFN5O2S |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nnnn1CC1CCCO1)C(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C15H17BrFN5O2S/c1-9(14(23)18-13-5-4-10(16)7-12(13)17)25-15-19-20-21-22(15)8-11-3-2-6-24-11/h4-5,7,9,11H,2-3,6,8H2,1H3,(H,18,23) |
| InChIKey | VQEZTAUAEXHCST-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |