C11H18N6O3S — CID 9388385
(2R)-N-(methylcarbamoyl)-2-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]sulfanylpropanamide (PubChem CID 9388385) has the molecular formula C11H18N6O3S and a molecular weight of 314.37 g/mol. Its IUPAC name is (2R)-N-(methylcarbamoyl)-2-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | (2R)-N-(methylcarbamoyl)-2-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 9388385 |
| Molecular Formula | C11H18N6O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (2R)-N-(methylcarbamoyl)-2-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]sulfanylpropanamide |
| SMILES | CNC(=O)NC(=O)[C@@H](C)Sc1nnnn1C[C@H]1CCCO1 |
| InChI | InChI=1S/C11H18N6O3S/c1-7(9(18)13-10(19)12-2)21-11-14-15-16-17(11)6-8-4-3-5-20-8/h7-8H,3-6H2,1-2H3,(H2,12,13,18,19)/t7-,8-/m1/s1 |
| InChIKey | ZCNPVOWRTUFCPR-HTQZYQBOSA-N |
| XLogP | -0.21 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |