C20H18F3N3OS3 — CID 121029975
1-thiophen-2-yl-N-[5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]cyclopentane-1-carboxamide (PubChem CID 121029975) has the molecular formula C20H18F3N3OS3 and a molecular weight of 469.58 g/mol. Its IUPAC name is 1-thiophen-2-yl-N-[5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]cyclopentane-1-carboxamide.
| Compound Name | 1-thiophen-2-yl-N-[5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 121029975 |
| Molecular Formula | C20H18F3N3OS3 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 1-thiophen-2-yl-N-[5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]cyclopentane-1-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2cccc(C(F)(F)F)c2)s1)C1(c2cccs2)CCCC1 |
| InChI | InChI=1S/C20H18F3N3OS3/c21-20(22,23)14-6-3-5-13(11-14)12-29-18-26-25-17(30-18)24-16(27)19(8-1-2-9-19)15-7-4-10-28-15/h3-7,10-11H,1-2,8-9,12H2,(H,24,25,27) |
| InChIKey | PSVVLLMSFJGVJL-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|