C12H10Cl3N3O2S2 — CID 7920097
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 7920097) has the molecular formula C12H10Cl3N3O2S2 and a molecular weight of 398.72 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 7920097 |
| Molecular Formula | C12H10Cl3N3O2S2 |
| Molecular Weight | 398.72 g/mol |
| Exact Mass | 396.93 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | CCSc1nnc(NC(=O)COc2cc(Cl)c(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C12H10Cl3N3O2S2/c1-2-21-12-18-17-11(22-12)16-10(19)5-20-9-4-7(14)6(13)3-8(9)15/h3-4H,2,5H2,1H3,(H,16,17,19) |
| InChIKey | UWFGYKXJCORIEQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.72 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|