C19H17N3OS2 — CID 606943
2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(2-phenylethenyl)phenyl]acetamide (PubChem CID 606943) has the molecular formula C19H17N3OS2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(2-phenylethenyl)phenyl]acetamide.
| Compound Name | 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(2-phenylethenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 606943 |
| Molecular Formula | C19H17N3OS2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(2-phenylethenyl)phenyl]acetamide |
| SMILES | Cc1nnc(SCC(=O)Nc2ccc(C=Cc3ccccc3)cc2)s1 |
| InChI | InChI=1S/C19H17N3OS2/c1-14-21-22-19(25-14)24-13-18(23)20-17-11-9-16(10-12-17)8-7-15-5-3-2-4-6-15/h2-12H,13H2,1H3,(H,20,23) |
| InChIKey | UWCMDRRQRVTWSE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|