C24H21N3OS2 — CID 3965817
2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-N',N'-diphenylacetohydrazide (PubChem CID 3965817) has the molecular formula C24H21N3OS2 and a molecular weight of 431.59 g/mol. Its IUPAC name is 2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-N',N'-diphenylacetohydrazide.
| Compound Name | 2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-N',N'-diphenylacetohydrazide |
|---|---|
| PubChem CID | 3965817 |
| Molecular Formula | C24H21N3OS2 |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]-N',N'-diphenylacetohydrazide |
| SMILES | Cc1ccc(-c2csc(SCC(=O)NN(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H21N3OS2/c1-18-12-14-19(15-13-18)22-16-29-24(25-22)30-17-23(28)26-27(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-16H,17H2,1H3,(H,26,28) |
| InChIKey | XRUKVVXFDJQOAK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|