C17H14N2O2S2 — CID 3678775
N-(2-hydroxyphenyl)-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide (PubChem CID 3678775) has the molecular formula C17H14N2O2S2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2-hydroxyphenyl)-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3678775 |
| Molecular Formula | C17H14N2O2S2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | N-(2-hydroxyphenyl)-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc(-c2ccccc2)cs1)Nc1ccccc1O |
| InChI | InChI=1S/C17H14N2O2S2/c20-15-9-5-4-8-13(15)18-16(21)11-23-17-19-14(10-22-17)12-6-2-1-3-7-12/h1-10,20H,11H2,(H,18,21) |
| InChIKey | UORYNHGRZVLGJT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|