C16H13N3O2S3 — CID 2563953
N'-[2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide (PubChem CID 2563953) has the molecular formula C16H13N3O2S3 and a molecular weight of 375.50 g/mol. Its IUPAC name is N'-[2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 2563953 |
| Molecular Formula | C16H13N3O2S3 |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | N'-[2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide |
| SMILES | O=C(CSc1nc(-c2ccccc2)cs1)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C16H13N3O2S3/c20-14(18-19-15(21)13-7-4-8-22-13)10-24-16-17-12(9-23-16)11-5-2-1-3-6-11/h1-9H,10H2,(H,18,20)(H,19,21) |
| InChIKey | DIWKAZDXDITDDL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|