C14H11N5O2S3 — CID 5297912
N'-[2-[(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide (PubChem CID 5297912) has the molecular formula C14H11N5O2S3 and a molecular weight of 377.48 g/mol. Its IUPAC name is N'-[2-[(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-[(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 5297912 |
| Molecular Formula | C14H11N5O2S3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | N'-[2-[(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide |
| SMILES | O=C(CSc1nnc(-c2cccnc2)s1)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C14H11N5O2S3/c20-11(16-17-12(21)10-4-2-6-22-10)8-23-14-19-18-13(24-14)9-3-1-5-15-7-9/h1-7H,8H2,(H,16,20)(H,17,21) |
| InChIKey | MICGSXDUPVAYOB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|