C20H32N3O2+ — CID 9472866
3,4-dimethyl-N-[2-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propylamino]-2-oxoethyl]benzamide (PubChem CID 9472866) has the molecular formula C20H32N3O2+ and a molecular weight of 346.50 g/mol. Its IUPAC name is 3,4-dimethyl-N-[2-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propylamino]-2-oxoethyl]benzamide.
| Compound Name | 3,4-dimethyl-N-[2-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9472866 |
| Molecular Formula | C20H32N3O2+ |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 3,4-dimethyl-N-[2-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propylamino]-2-oxoethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)NCCC[NH+]2CCCC[C@@H]2C)cc1C |
| InChI | InChI=1S/C20H31N3O2/c1-15-8-9-18(13-16(15)2)20(25)22-14-19(24)21-10-6-12-23-11-5-4-7-17(23)3/h8-9,13,17H,4-7,10-12,14H2,1-3H3,(H,21,24)(H,22,25)/p+1/t17-/m0/s1 |
| InChIKey | YFTTZNXFJZZFIU-KRWDZBQOSA-O |
| XLogP | 1.00 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|