C21H32N3O2+ — CID 9473518
N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide (PubChem CID 9473518) has the molecular formula C21H32N3O2+ and a molecular weight of 358.51 g/mol. Its IUPAC name is N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide.
| Compound Name | N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 9473518 |
| Molecular Formula | C21H32N3O2+ |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
| SMILES | C[C@H]1CCCC[NH+]1CCCNC(=O)c1ccc(CN2CCCC2=O)cc1 |
| InChI | InChI=1S/C21H31N3O2/c1-17-6-2-3-13-23(17)15-5-12-22-21(26)19-10-8-18(9-11-19)16-24-14-4-7-20(24)25/h8-11,17H,2-7,12-16H2,1H3,(H,22,26)/p+1/t17-/m0/s1 |
| InChIKey | OLSIDGMDVHXMFK-KRWDZBQOSA-O |
| XLogP | 1.39 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|