C20H33N2O2+ — CID 9472886
N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-2-(2,4,6-trimethylphenoxy)acetamide (PubChem CID 9472886) has the molecular formula C20H33N2O2+ and a molecular weight of 333.50 g/mol. Its IUPAC name is N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-2-(2,4,6-trimethylphenoxy)acetamide.
| Compound Name | N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-2-(2,4,6-trimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 9472886 |
| Molecular Formula | C20H33N2O2+ |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-2-(2,4,6-trimethylphenoxy)acetamide |
| SMILES | Cc1cc(C)c(OCC(=O)NCCC[NH+]2CCCC[C@@H]2C)c(C)c1 |
| InChI | InChI=1S/C20H32N2O2/c1-15-12-16(2)20(17(3)13-15)24-14-19(23)21-9-7-11-22-10-6-5-8-18(22)4/h12-13,18H,5-11,14H2,1-4H3,(H,21,23)/p+1/t18-/m0/s1 |
| InChIKey | GRNOZSYYMVEFCW-SFHVURJKSA-O |
| XLogP | 1.95 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|