C23H38N3O3S+ — CID 9472669
N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-3-(4-piperidin-1-ylsulfonylphenyl)propanamide (PubChem CID 9472669) has the molecular formula C23H38N3O3S+ and a molecular weight of 436.64 g/mol. Its IUPAC name is N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-3-(4-piperidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-3-(4-piperidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 9472669 |
| Molecular Formula | C23H38N3O3S+ |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]-3-(4-piperidin-1-ylsulfonylphenyl)propanamide |
| SMILES | C[C@H]1CCCC[NH+]1CCCNC(=O)CCc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H37N3O3S/c1-20-8-3-6-16-25(20)17-7-15-24-23(27)14-11-21-9-12-22(13-10-21)30(28,29)26-18-4-2-5-19-26/h9-10,12-13,20H,2-8,11,14-19H2,1H3,(H,24,27)/p+1/t20-/m0/s1 |
| InChIKey | WTENYKDQTJJUDS-FQEVSTJZSA-O |
| XLogP | 1.76 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|