C21H33FN3O3S+ — CID 9473978
(3R)-1-(4-fluorophenyl)sulfonyl-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]piperidine-3-carboxamide (PubChem CID 9473978) has the molecular formula C21H33FN3O3S+ and a molecular weight of 426.58 g/mol. Its IUPAC name is (3R)-1-(4-fluorophenyl)sulfonyl-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-(4-fluorophenyl)sulfonyl-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 9473978 |
| Molecular Formula | C21H33FN3O3S+ |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (3R)-1-(4-fluorophenyl)sulfonyl-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]piperidine-3-carboxamide |
| SMILES | C[C@H]1CCCC[NH+]1CCCNC(=O)[C@@H]1CCCN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H32FN3O3S/c1-17-6-2-3-13-24(17)14-5-12-23-21(26)18-7-4-15-25(16-18)29(27,28)20-10-8-19(22)9-11-20/h8-11,17-18H,2-7,12-16H2,1H3,(H,23,26)/p+1/t17-,18+/m0/s1 |
| InChIKey | UVAMNWRTDPXNPO-ZWKOTPCHSA-O |
| XLogP | 1.19 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|