C24H36N3O+ — CID 7202274
3,5-dimethyl-1-[(3-methylphenyl)methyl]-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]pyrrole-2-carboxamide (PubChem CID 7202274) has the molecular formula C24H36N3O+ and a molecular weight of 382.57 g/mol. Its IUPAC name is 3,5-dimethyl-1-[(3-methylphenyl)methyl]-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]pyrrole-2-carboxamide.
| Compound Name | 3,5-dimethyl-1-[(3-methylphenyl)methyl]-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 7202274 |
| Molecular Formula | C24H36N3O+ |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | 3,5-dimethyl-1-[(3-methylphenyl)methyl]-N-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyl]pyrrole-2-carboxamide |
| SMILES | Cc1cccc(Cn2c(C)cc(C)c2C(=O)NCCC[NH+]2CCCC[C@@H]2C)c1 |
| InChI | InChI=1S/C24H35N3O/c1-18-9-7-11-22(15-18)17-27-21(4)16-19(2)23(27)24(28)25-12-8-14-26-13-6-5-10-20(26)3/h7,9,11,15-16,20H,5-6,8,10,12-14,17H2,1-4H3,(H,25,28)/p+1/t20-/m0/s1 |
| InChIKey | YEBRHQFGTYLOAS-FQEVSTJZSA-O |
| XLogP | 3.04 |
| TPSA | 38.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|