C21H18N4O5S — CID 55486432
N'-[3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]-3-nitrobenzohydrazide (PubChem CID 55486432) has the molecular formula C21H18N4O5S and a molecular weight of 438.47 g/mol. Its IUPAC name is N'-[3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 55486432 |
| Molecular Formula | C21H18N4O5S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | N'-[3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]-3-nitrobenzohydrazide |
| SMILES | Cc1nc(COc2cccc(C=CC(=O)NNC(=O)c3cccc([N+](=O)[O-])c3)c2)cs1 |
| InChI | InChI=1S/C21H18N4O5S/c1-14-22-17(13-31-14)12-30-19-7-2-4-15(10-19)8-9-20(26)23-24-21(27)16-5-3-6-18(11-16)25(28)29/h2-11,13H,12H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | MHZPVBMUDHFFMH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|