C13H12N4O4S — CID 29259935
N'-[2-(2-methyl-1,3-thiazol-4-yl)acetyl]-3-nitrobenzohydrazide (PubChem CID 29259935) has the molecular formula C13H12N4O4S and a molecular weight of 320.33 g/mol. Its IUPAC name is N'-[2-(2-methyl-1,3-thiazol-4-yl)acetyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[2-(2-methyl-1,3-thiazol-4-yl)acetyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 29259935 |
| Molecular Formula | C13H12N4O4S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N'-[2-(2-methyl-1,3-thiazol-4-yl)acetyl]-3-nitrobenzohydrazide |
| SMILES | Cc1nc(CC(=O)NNC(=O)c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C13H12N4O4S/c1-8-14-10(7-22-8)6-12(18)15-16-13(19)9-3-2-4-11(5-9)17(20)21/h2-5,7H,6H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | SVVJZYTYZLGUOQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|