C25H29N3O4S2 — CID 30304502
(E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 30304502) has the molecular formula C25H29N3O4S2 and a molecular weight of 499.66 g/mol. Its IUPAC name is (E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 30304502 |
| Molecular Formula | C25H29N3O4S2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | (E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | Cc1nc(COc2cccc(/C=C/C(=O)NCc3ccccc3CS(=O)(=O)NC(C)C)c2)cs1 |
| InChI | InChI=1S/C25H29N3O4S2/c1-18(2)28-34(30,31)17-22-9-5-4-8-21(22)14-26-25(29)12-11-20-7-6-10-24(13-20)32-15-23-16-33-19(3)27-23/h4-13,16,18,28H,14-15,17H2,1-3H3,(H,26,29)/b12-11+ |
| InChIKey | UCMRJUZCFAWOOE-VAWYXSNFSA-N |
| XLogP | 4.19 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|