C26H28FN3O3S — CID 55522699
(E)-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide (PubChem CID 55522699) has the molecular formula C26H28FN3O3S and a molecular weight of 481.59 g/mol. Its IUPAC name is (E)-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55522699 |
| Molecular Formula | C26H28FN3O3S |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (E)-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
| SMILES | Cc1nc(COc2cccc(/C=C/C(=O)NCC(c3ccc(F)cc3)N3CCOCC3)c2)cs1 |
| InChI | InChI=1S/C26H28FN3O3S/c1-19-29-23(18-34-19)17-33-24-4-2-3-20(15-24)5-10-26(31)28-16-25(30-11-13-32-14-12-30)21-6-8-22(27)9-7-21/h2-10,15,18,25H,11-14,16-17H2,1H3,(H,28,31)/b10-5+ |
| InChIKey | LSLAZFBQDKAWNY-BJMVGYQFSA-N |
| XLogP | 4.37 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|