C22H32N2O4 — CID 102603261
3-(3,4-diethoxyphenyl)-1-[4-(oxolan-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 102603261) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is 3-(3,4-diethoxyphenyl)-1-[4-(oxolan-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(3,4-diethoxyphenyl)-1-[4-(oxolan-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 102603261 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 3-(3,4-diethoxyphenyl)-1-[4-(oxolan-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | CCOc1ccc(C=CC(=O)N2CCN(CC3CCCO3)CC2)cc1OCC |
| InChI | InChI=1S/C22H32N2O4/c1-3-26-20-9-7-18(16-21(20)27-4-2)8-10-22(25)24-13-11-23(12-14-24)17-19-6-5-15-28-19/h7-10,16,19H,3-6,11-15,17H2,1-2H3 |
| InChIKey | YFWCYRQKAQGMLD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|