C21H27F2N3O4 — CID 55451715
2-[4-[3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]piperazin-1-yl]-N-prop-2-enylacetamide (PubChem CID 55451715) has the molecular formula C21H27F2N3O4 and a molecular weight of 423.46 g/mol. Its IUPAC name is 2-[4-[3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]piperazin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[4-[3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]piperazin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 55451715 |
| Molecular Formula | C21H27F2N3O4 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-[4-[3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]piperazin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CCN(C(=O)C=Cc2ccc(OC(F)F)c(OCC)c2)CC1 |
| InChI | InChI=1S/C21H27F2N3O4/c1-3-9-24-19(27)15-25-10-12-26(13-11-25)20(28)8-6-16-5-7-17(30-21(22)23)18(14-16)29-4-2/h3,5-8,14,21H,1,4,9-13,15H2,2H3,(H,24,27) |
| InChIKey | VTCJXZUPPSNOSR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|