C21H24F2N2O6S — CID 30752288
(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]prop-2-enamide (PubChem CID 30752288) has the molecular formula C21H24F2N2O6S and a molecular weight of 470.49 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 30752288 |
| Molecular Formula | C21H24F2N2O6S |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)NCCNS(=O)(=O)c2ccc(OC)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C21H24F2N2O6S/c1-3-30-19-14-15(4-10-18(19)31-21(22)23)5-11-20(26)24-12-13-25-32(27,28)17-8-6-16(29-2)7-9-17/h4-11,14,21,25H,3,12-13H2,1-2H3,(H,24,26)/b11-5+ |
| InChIKey | XAKZXJRXYBDVER-VZUCSPMQSA-N |
| XLogP | 2.80 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|