C22H28N2O6S — CID 30752253
(E)-3-(3,4-diethoxyphenyl)-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]prop-2-enamide (PubChem CID 30752253) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is (E)-3-(3,4-diethoxyphenyl)-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-diethoxyphenyl)-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 30752253 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (E)-3-(3,4-diethoxyphenyl)-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)NCCNS(=O)(=O)c2ccc(OC)cc2)cc1OCC |
| InChI | InChI=1S/C22H28N2O6S/c1-4-29-20-12-6-17(16-21(20)30-5-2)7-13-22(25)23-14-15-24-31(26,27)19-10-8-18(28-3)9-11-19/h6-13,16,24H,4-5,14-15H2,1-3H3,(H,23,25)/b13-7+ |
| InChIKey | JSDUCTXDDUUMCF-NTUHNPAUSA-N |
| XLogP | 2.60 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|