C20H22BrNO3 — CID 2450532
(E)-3-(3-bromophenyl)-N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-methylprop-2-enamide (PubChem CID 2450532) has the molecular formula C20H22BrNO3 and a molecular weight of 404.30 g/mol. Its IUPAC name is (E)-3-(3-bromophenyl)-N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(3-bromophenyl)-N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 2450532 |
| Molecular Formula | C20H22BrNO3 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | (E)-3-(3-bromophenyl)-N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-methylprop-2-enamide |
| SMILES | CCOc1ccc(CN(C)C(=O)/C=C/c2cccc(Br)c2)cc1OC |
| InChI | InChI=1S/C20H22BrNO3/c1-4-25-18-10-8-16(13-19(18)24-3)14-22(2)20(23)11-9-15-6-5-7-17(21)12-15/h5-13H,4,14H2,1-3H3/b11-9+ |
| InChIKey | FGRRKLMLXJSZJY-PKNBQFBNSA-N |
| XLogP | 4.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|