C18H17BrO4 — CID 9097097
(3,4-dimethoxyphenyl)methyl (E)-3-(3-bromophenyl)prop-2-enoate (PubChem CID 9097097) has the molecular formula C18H17BrO4 and a molecular weight of 377.23 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methyl (E)-3-(3-bromophenyl)prop-2-enoate.
| Compound Name | (3,4-dimethoxyphenyl)methyl (E)-3-(3-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9097097 |
| Molecular Formula | C18H17BrO4 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | (3,4-dimethoxyphenyl)methyl (E)-3-(3-bromophenyl)prop-2-enoate |
| SMILES | COc1ccc(COC(=O)/C=C/c2cccc(Br)c2)cc1OC |
| InChI | InChI=1S/C18H17BrO4/c1-21-16-8-6-14(11-17(16)22-2)12-23-18(20)9-7-13-4-3-5-15(19)10-13/h3-11H,12H2,1-2H3/b9-7+ |
| InChIKey | BJDVCSLVIBDSAE-VQHVLOKHSA-N |
| XLogP | 4.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|