C18H18F2N2O3 — CID 78770908
(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-methyl-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 78770908) has the molecular formula C18H18F2N2O3 and a molecular weight of 348.35 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-methyl-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-methyl-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 78770908 |
| Molecular Formula | C18H18F2N2O3 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-methyl-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(C)Cc2cccnc2)ccc1OC(F)F |
| InChI | InChI=1S/C18H18F2N2O3/c1-22(12-14-4-3-9-21-11-14)17(23)8-6-13-5-7-15(25-18(19)20)16(10-13)24-2/h3-11,18H,12H2,1-2H3/b8-6+ |
| InChIKey | XDNPTLZDQLOHDY-SOFGYWHQSA-N |
| XLogP | 3.36 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|