C18H20N2O3 — CID 78770928
(E)-3-(2,5-dimethoxyphenyl)-N-methyl-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 78770928) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (E)-3-(2,5-dimethoxyphenyl)-N-methyl-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(2,5-dimethoxyphenyl)-N-methyl-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 78770928 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (E)-3-(2,5-dimethoxyphenyl)-N-methyl-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)N(C)Cc2cccnc2)c1 |
| InChI | InChI=1S/C18H20N2O3/c1-20(13-14-5-4-10-19-12-14)18(21)9-6-15-11-16(22-2)7-8-17(15)23-3/h4-12H,13H2,1-3H3/b9-6+ |
| InChIKey | KIAOIAUBOCBYLU-RMKNXTFCSA-N |
| XLogP | 2.77 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|