C23H28N2O3 — CID 78816997
(E)-3-(2,5-dimethoxyphenyl)-N-methyl-N-[(2-pyrrolidin-1-ylphenyl)methyl]prop-2-enamide (PubChem CID 78816997) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is (E)-3-(2,5-dimethoxyphenyl)-N-methyl-N-[(2-pyrrolidin-1-ylphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-dimethoxyphenyl)-N-methyl-N-[(2-pyrrolidin-1-ylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 78816997 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | (E)-3-(2,5-dimethoxyphenyl)-N-methyl-N-[(2-pyrrolidin-1-ylphenyl)methyl]prop-2-enamide |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)N(C)Cc2ccccc2N2CCCC2)c1 |
| InChI | InChI=1S/C23H28N2O3/c1-24(17-19-8-4-5-9-21(19)25-14-6-7-15-25)23(26)13-10-18-16-20(27-2)11-12-22(18)28-3/h4-5,8-13,16H,6-7,14-15,17H2,1-3H3/b13-10+ |
| InChIKey | ODHNCLSJQUQTIC-JLHYYAGUSA-N |
| XLogP | 3.98 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|