C22H28N4O3 — CID 37245607
(E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-methyl-N-[(2-piperidin-1-ylphenyl)methyl]prop-2-enamide (PubChem CID 37245607) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-methyl-N-[(2-piperidin-1-ylphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-methyl-N-[(2-piperidin-1-ylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 37245607 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-methyl-N-[(2-piperidin-1-ylphenyl)methyl]prop-2-enamide |
| SMILES | CN(Cc1ccccc1N1CCCCC1)C(=O)/C=C/c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C22H28N4O3/c1-23(15-17-9-5-6-10-19(17)26-13-7-4-8-14-26)20(27)12-11-18-16-24(2)22(29)25(3)21(18)28/h5-6,9-12,16H,4,7-8,13-15H2,1-3H3/b12-11+ |
| InChIKey | YOJLIEZDAKZGQU-VAWYXSNFSA-N |
| XLogP | 1.75 |
| TPSA | 67.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|