C21H21N3O3 — CID 55596465
3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-methyl-N-(naphthalen-1-ylmethyl)prop-2-enamide (PubChem CID 55596465) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-methyl-N-(naphthalen-1-ylmethyl)prop-2-enamide.
| Compound Name | 3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-methyl-N-(naphthalen-1-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 55596465 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-methyl-N-(naphthalen-1-ylmethyl)prop-2-enamide |
| SMILES | CN(Cc1cccc2ccccc12)C(=O)C=Cc1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C21H21N3O3/c1-22(13-16-9-6-8-15-7-4-5-10-18(15)16)19(25)12-11-17-14-23(2)21(27)24(3)20(17)26/h4-12,14H,13H2,1-3H3 |
| InChIKey | HMSYSSCPTYOELI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|