C17H16F3N3O4 — CID 33262160
(E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-[[2-(trifluoromethoxy)phenyl]methyl]prop-2-enamide (PubChem CID 33262160) has the molecular formula C17H16F3N3O4 and a molecular weight of 383.33 g/mol. Its IUPAC name is (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-[[2-(trifluoromethoxy)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-[[2-(trifluoromethoxy)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 33262160 |
| Molecular Formula | C17H16F3N3O4 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-[[2-(trifluoromethoxy)phenyl]methyl]prop-2-enamide |
| SMILES | Cn1cc(/C=C/C(=O)NCc2ccccc2OC(F)(F)F)c(=O)n(C)c1=O |
| InChI | InChI=1S/C17H16F3N3O4/c1-22-10-12(15(25)23(2)16(22)26)7-8-14(24)21-9-11-5-3-4-6-13(11)27-17(18,19)20/h3-8,10H,9H2,1-2H3,(H,21,24)/b8-7+ |
| InChIKey | SIZAOEXNZILXPK-BQYQJAHWSA-N |
| XLogP | 1.31 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|