C16H16ClN3O3 — CID 42153438
(E)-N-[(4-chlorophenyl)methyl]-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide (PubChem CID 42153438) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is (E)-N-[(4-chlorophenyl)methyl]-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[(4-chlorophenyl)methyl]-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 42153438 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | (E)-N-[(4-chlorophenyl)methyl]-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide |
| SMILES | Cn1cc(/C=C/C(=O)NCc2ccc(Cl)cc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H16ClN3O3/c1-19-10-12(15(22)20(2)16(19)23)5-8-14(21)18-9-11-3-6-13(17)7-4-11/h3-8,10H,9H2,1-2H3,(H,18,21)/b8-5+ |
| InChIKey | JBXRYUBDHZYJKV-VMPITWQZSA-N |
| XLogP | 1.07 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|