C18H26N6O5 — CID 167888960
4-(carbamoylamino)-N-[(Z)-4-[[(E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoyl]amino]but-2-enyl]butanamide (PubChem CID 167888960) has the molecular formula C18H26N6O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is 4-(carbamoylamino)-N-[(Z)-4-[[(E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoyl]amino]but-2-enyl]butanamide.
| Compound Name | 4-(carbamoylamino)-N-[(Z)-4-[[(E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoyl]amino]but-2-enyl]butanamide |
|---|---|
| PubChem CID | 167888960 |
| Molecular Formula | C18H26N6O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 4-(carbamoylamino)-N-[(Z)-4-[[(E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoyl]amino]but-2-enyl]butanamide |
| SMILES | Cn1cc(/C=C/C(=O)NC/C=C\CNC(=O)CCCNC(N)=O)c(=O)n(C)c1=O |
| InChI | InChI=1S/C18H26N6O5/c1-23-12-13(16(27)24(2)18(23)29)7-8-15(26)21-10-4-3-9-20-14(25)6-5-11-22-17(19)28/h3-4,7-8,12H,5-6,9-11H2,1-2H3,(H,20,25)(H,21,26)(H3,19,22,28)/b4-3-,8-7+ |
| InChIKey | FMCGXMAUZRWJCR-ODYTWBPASA-N |
| XLogP | -1.67 |
| TPSA | 157.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|