C14H21N3O3 — CID 17491136
(E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-(3-methylbutyl)prop-2-enamide (PubChem CID 17491136) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-(3-methylbutyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-(3-methylbutyl)prop-2-enamide |
|---|---|
| PubChem CID | 17491136 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-(3-methylbutyl)prop-2-enamide |
| SMILES | CC(C)CCNC(=O)/C=C/c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H21N3O3/c1-10(2)7-8-15-12(18)6-5-11-9-16(3)14(20)17(4)13(11)19/h5-6,9-10H,7-8H2,1-4H3,(H,15,18)/b6-5+ |
| InChIKey | FMVJRAYGPIBKNP-AATRIKPKSA-N |
| XLogP | 0.26 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|