C21H23Cl2N3O — CID 70046129
3-[4-chloro-2-(4-methylpiperazin-1-yl)phenyl]-N-[(4-chlorophenyl)methyl]prop-2-enamide (PubChem CID 70046129) has the molecular formula C21H23Cl2N3O and a molecular weight of 404.34 g/mol. Its IUPAC name is 3-[4-chloro-2-(4-methylpiperazin-1-yl)phenyl]-N-[(4-chlorophenyl)methyl]prop-2-enamide.
| Compound Name | 3-[4-chloro-2-(4-methylpiperazin-1-yl)phenyl]-N-[(4-chlorophenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 70046129 |
| Molecular Formula | C21H23Cl2N3O |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 3-[4-chloro-2-(4-methylpiperazin-1-yl)phenyl]-N-[(4-chlorophenyl)methyl]prop-2-enamide |
| SMILES | CN1CCN(c2cc(Cl)ccc2C=CC(=O)NCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H23Cl2N3O/c1-25-10-12-26(13-11-25)20-14-19(23)8-4-17(20)5-9-21(27)24-15-16-2-6-18(22)7-3-16/h2-9,14H,10-13,15H2,1H3,(H,24,27) |
| InChIKey | NPQJAOFRVSGKES-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|