C14H19ClN4O2 — CID 44995846
N-[(4-chlorophenyl)methyl]-N'-(4-methylpiperazin-1-yl)oxamide (PubChem CID 44995846) has the molecular formula C14H19ClN4O2 and a molecular weight of 310.78 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N'-(4-methylpiperazin-1-yl)oxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-N'-(4-methylpiperazin-1-yl)oxamide |
|---|---|
| PubChem CID | 44995846 |
| Molecular Formula | C14H19ClN4O2 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N'-(4-methylpiperazin-1-yl)oxamide |
| SMILES | CN1CCN(NC(=O)C(=O)NCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C14H19ClN4O2/c1-18-6-8-19(9-7-18)17-14(21)13(20)16-10-11-2-4-12(15)5-3-11/h2-5H,6-10H2,1H3,(H,16,20)(H,17,21) |
| InChIKey | GSCHMFGZNICAMY-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|