C27H33ClN4O2 — CID 139762296
N-[(4-chlorophenyl)methyl]-3-[2-(4-methylpiperazin-1-yl)-4-(piperidine-1-carbonyl)phenyl]prop-2-enamide (PubChem CID 139762296) has the molecular formula C27H33ClN4O2 and a molecular weight of 481.04 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-3-[2-(4-methylpiperazin-1-yl)-4-(piperidine-1-carbonyl)phenyl]prop-2-enamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-3-[2-(4-methylpiperazin-1-yl)-4-(piperidine-1-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 139762296 |
| Molecular Formula | C27H33ClN4O2 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-3-[2-(4-methylpiperazin-1-yl)-4-(piperidine-1-carbonyl)phenyl]prop-2-enamide |
| SMILES | CN1CCN(c2cc(C(=O)N3CCCCC3)ccc2C=CC(=O)NCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C27H33ClN4O2/c1-30-15-17-31(18-16-30)25-19-23(27(34)32-13-3-2-4-14-32)8-7-22(25)9-12-26(33)29-20-21-5-10-24(28)11-6-21/h5-12,19H,2-4,13-18,20H2,1H3,(H,29,33) |
| InChIKey | UCTCJOQRSUSOMJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|