C30H26N2O3 — CID 127025128
(E)-N-benzyl-N-(9H-carbazol-4-ylmethyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 127025128) has the molecular formula C30H26N2O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is (E)-N-benzyl-N-(9H-carbazol-4-ylmethyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-benzyl-N-(9H-carbazol-4-ylmethyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 127025128 |
| Molecular Formula | C30H26N2O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | (E)-N-benzyl-N-(9H-carbazol-4-ylmethyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(Cc2ccccc2)Cc2cccc3[nH]c4ccccc4c23)ccc1O |
| InChI | InChI=1S/C30H26N2O3/c1-35-28-18-21(14-16-27(28)33)15-17-29(34)32(19-22-8-3-2-4-9-22)20-23-10-7-13-26-30(23)24-11-5-6-12-25(24)31-26/h2-18,31,33H,19-20H2,1H3/b17-15+ |
| InChIKey | JAKPSZRITXQAMX-BMRADRMJSA-N |
| XLogP | 6.28 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|