C23H17NO5 — CID 101038953
3-hydroxy-2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-10H-acridin-9-one (PubChem CID 101038953) has the molecular formula C23H17NO5 and a molecular weight of 387.39 g/mol. Its IUPAC name is 3-hydroxy-2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-10H-acridin-9-one.
| Compound Name | 3-hydroxy-2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-10H-acridin-9-one |
|---|---|
| PubChem CID | 101038953 |
| Molecular Formula | C23H17NO5 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 3-hydroxy-2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-10H-acridin-9-one |
| SMILES | COc1cc(/C=C/C(=O)c2cc3c(=O)c4ccccc4[nH]c3cc2O)ccc1O |
| InChI | InChI=1S/C23H17NO5/c1-29-22-10-13(7-9-20(22)26)6-8-19(25)16-11-15-18(12-21(16)27)24-17-5-3-2-4-14(17)23(15)28/h2-12,26-27H,1H3,(H,24,28)/b8-6+ |
| InChIKey | LAZQOIYSMWOMQS-SOFGYWHQSA-N |
| XLogP | 4.00 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|