C25H20N2O3 — CID 3021328
3-(4-hydroxy-3-methoxyphenyl)-1-[4-(1H-indol-3-ylmethylideneamino)phenyl]prop-2-en-1-one (PubChem CID 3021328) has the molecular formula C25H20N2O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-(4-hydroxy-3-methoxyphenyl)-1-[4-(1H-indol-3-ylmethylideneamino)phenyl]prop-2-en-1-one.
| Compound Name | 3-(4-hydroxy-3-methoxyphenyl)-1-[4-(1H-indol-3-ylmethylideneamino)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3021328 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 3-(4-hydroxy-3-methoxyphenyl)-1-[4-(1H-indol-3-ylmethylideneamino)phenyl]prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2ccc(/N=C/c3c[nH]c4ccccc34)cc2)ccc1O |
| InChI | InChI=1S/C25H20N2O3/c1-30-25-14-17(7-13-24(25)29)6-12-23(28)18-8-10-20(11-9-18)26-15-19-16-27-22-5-3-2-4-21(19)22/h2-16,27,29H,1H3/b12-6?,26-15+ |
| InChIKey | ZWHIRVUMDSIUBU-GDOWTDJYSA-N |
| XLogP | 5.53 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|