C21H18F5NO7S — CID 118056202
[2,3-diacetyloxy-5-[(E)-3-oxo-3-[4-(pentafluoro-λ6-sulfanyl)anilino]prop-1-enyl]phenyl] acetate (PubChem CID 118056202) has the molecular formula C21H18F5NO7S and a molecular weight of 523.43 g/mol. Its IUPAC name is [2,3-diacetyloxy-5-[(E)-3-oxo-3-[4-(pentafluoro-λ6-sulfanyl)anilino]prop-1-enyl]phenyl] acetate.
| Compound Name | [2,3-diacetyloxy-5-[(E)-3-oxo-3-[4-(pentafluoro-λ6-sulfanyl)anilino]prop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 118056202 |
| Molecular Formula | C21H18F5NO7S |
| Molecular Weight | 523.43 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | [2,3-diacetyloxy-5-[(E)-3-oxo-3-[4-(pentafluoro-λ6-sulfanyl)anilino]prop-1-enyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(/C=C/C(=O)Nc2ccc(S(F)(F)(F)(F)F)cc2)cc(OC(C)=O)c1OC(C)=O |
| InChI | InChI=1S/C21H18F5NO7S/c1-12(28)32-18-10-15(11-19(33-13(2)29)21(18)34-14(3)30)4-9-20(31)27-16-5-7-17(8-6-16)35(22,23,24,25)26/h4-11H,1-3H3,(H,27,31)/b9-4+ |
| InChIKey | UTSOFBFTCALACM-RUDMXATFSA-N |
| XLogP | 5.77 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.43 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|