C24H26F5NO3S — CID 122500376
(E)-3-[4-(3-methylbut-2-enoxy)-3-(2-methylprop-1-enoxy)phenyl]-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]prop-2-enamide (PubChem CID 122500376) has the molecular formula C24H26F5NO3S and a molecular weight of 503.53 g/mol. Its IUPAC name is (E)-3-[4-(3-methylbut-2-enoxy)-3-(2-methylprop-1-enoxy)phenyl]-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(3-methylbut-2-enoxy)-3-(2-methylprop-1-enoxy)phenyl]-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122500376 |
| Molecular Formula | C24H26F5NO3S |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | (E)-3-[4-(3-methylbut-2-enoxy)-3-(2-methylprop-1-enoxy)phenyl]-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]prop-2-enamide |
| SMILES | CC(C)=CCOc1ccc(/C=C/C(=O)Nc2ccc(S(F)(F)(F)(F)F)cc2)cc1OC=C(C)C |
| InChI | InChI=1S/C24H26F5NO3S/c1-17(2)13-14-32-22-11-5-19(15-23(22)33-16-18(3)4)6-12-24(31)30-20-7-9-21(10-8-20)34(25,26,27,28)29/h5-13,15-16H,14H2,1-4H3,(H,30,31)/b12-6+ |
| InChIKey | APJKIYHBLXMOOH-WUXMJOGZSA-N |
| XLogP | 8.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|