C20H19F6NO2S — CID 140735342
3-[3-fluoro-4-hydroxy-5-(3-methylbut-2-enyl)phenyl]-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]prop-2-enamide (PubChem CID 140735342) has the molecular formula C20H19F6NO2S and a molecular weight of 451.43 g/mol. Its IUPAC name is 3-[3-fluoro-4-hydroxy-5-(3-methylbut-2-enyl)phenyl]-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]prop-2-enamide.
| Compound Name | 3-[3-fluoro-4-hydroxy-5-(3-methylbut-2-enyl)phenyl]-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 140735342 |
| Molecular Formula | C20H19F6NO2S |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 3-[3-fluoro-4-hydroxy-5-(3-methylbut-2-enyl)phenyl]-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]prop-2-enamide |
| SMILES | CC(C)=CCc1cc(C=CC(=O)Nc2ccc(S(F)(F)(F)(F)F)cc2)cc(F)c1O |
| InChI | InChI=1S/C20H19F6NO2S/c1-13(2)3-5-15-11-14(12-18(21)20(15)29)4-10-19(28)27-16-6-8-17(9-7-16)30(22,23,24,25)26/h3-4,6-12,29H,5H2,1-2H3,(H,27,28) |
| InChIKey | LMRHJMXUEKNUHA-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|