C20H15F6NO2S5 — CID 122483042
[2-[3-[3-fluoro-4-hydroxy-5-(3-methylbut-2-enyl)phenyl]prop-2-enoylamino]-3,4,5,6-tetrakis(fluorosulfanyl)phenyl] thiohypofluorite (PubChem CID 122483042) has the molecular formula C20H15F6NO2S5 and a molecular weight of 575.67 g/mol. Its IUPAC name is [2-[3-[3-fluoro-4-hydroxy-5-(3-methylbut-2-enyl)phenyl]prop-2-enoylamino]-3,4,5,6-tetrakis(fluorosulfanyl)phenyl] thiohypofluorite.
| Compound Name | [2-[3-[3-fluoro-4-hydroxy-5-(3-methylbut-2-enyl)phenyl]prop-2-enoylamino]-3,4,5,6-tetrakis(fluorosulfanyl)phenyl] thiohypofluorite |
|---|---|
| PubChem CID | 122483042 |
| Molecular Formula | C20H15F6NO2S5 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 574.96 |
| IUPAC Name | [2-[3-[3-fluoro-4-hydroxy-5-(3-methylbut-2-enyl)phenyl]prop-2-enoylamino]-3,4,5,6-tetrakis(fluorosulfanyl)phenyl] thiohypofluorite |
| SMILES | CC(C)=CCc1cc(C=CC(=O)Nc2c(SF)c(SF)c(SF)c(SF)c2SF)cc(F)c1O |
| InChI | InChI=1S/C20H15F6NO2S5/c1-9(2)3-5-11-7-10(8-12(21)15(11)29)4-6-13(28)27-14-16(30-22)18(32-24)20(34-26)19(33-25)17(14)31-23/h3-4,6-8,29H,5H2,1-2H3,(H,27,28) |
| InChIKey | KHJJPIJLRSWHKS-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|