C25H29NO3 — CID 122498375
(E)-3-[4-(3-methylbut-2-enoxy)-3-(2-methylprop-1-enoxy)phenyl]-N-(4-methylphenyl)prop-2-enamide (PubChem CID 122498375) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is (E)-3-[4-(3-methylbut-2-enoxy)-3-(2-methylprop-1-enoxy)phenyl]-N-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(3-methylbut-2-enoxy)-3-(2-methylprop-1-enoxy)phenyl]-N-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 122498375 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (E)-3-[4-(3-methylbut-2-enoxy)-3-(2-methylprop-1-enoxy)phenyl]-N-(4-methylphenyl)prop-2-enamide |
| SMILES | CC(C)=CCOc1ccc(/C=C/C(=O)Nc2ccc(C)cc2)cc1OC=C(C)C |
| InChI | InChI=1S/C25H29NO3/c1-18(2)14-15-28-23-12-8-21(16-24(23)29-17-19(3)4)9-13-25(27)26-22-10-6-20(5)7-11-22/h6-14,16-17H,15H2,1-5H3,(H,26,27)/b13-9+ |
| InChIKey | NCLFZDZRJMREAV-UKTHLTGXSA-N |
| XLogP | 6.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|