C20H17ClO6 — CID 87792548
[2,6-diacetyloxy-4-(2-phenylethenyl)phenyl] 2-chloroacetate (PubChem CID 87792548) has the molecular formula C20H17ClO6 and a molecular weight of 388.80 g/mol. Its IUPAC name is [2,6-diacetyloxy-4-(2-phenylethenyl)phenyl] 2-chloroacetate.
| Compound Name | [2,6-diacetyloxy-4-(2-phenylethenyl)phenyl] 2-chloroacetate |
|---|---|
| PubChem CID | 87792548 |
| Molecular Formula | C20H17ClO6 |
| Molecular Weight | 388.80 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | [2,6-diacetyloxy-4-(2-phenylethenyl)phenyl] 2-chloroacetate |
| SMILES | CC(=O)Oc1cc(C=Cc2ccccc2)cc(OC(C)=O)c1OC(=O)CCl |
| InChI | InChI=1S/C20H17ClO6/c1-13(22)25-17-10-16(9-8-15-6-4-3-5-7-15)11-18(26-14(2)23)20(17)27-19(24)12-21/h3-11H,12H2,1-2H3 |
| InChIKey | SFDDKVBENQECET-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.80 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|