C19H18Cl2O2 — CID 173024201
[2,4-dichloro-6-(2-phenylethenyl)-3-propan-2-ylphenyl] acetate (PubChem CID 173024201) has the molecular formula C19H18Cl2O2 and a molecular weight of 349.26 g/mol. Its IUPAC name is [2,4-dichloro-6-(2-phenylethenyl)-3-propan-2-ylphenyl] acetate.
| Compound Name | [2,4-dichloro-6-(2-phenylethenyl)-3-propan-2-ylphenyl] acetate |
|---|---|
| PubChem CID | 173024201 |
| Molecular Formula | C19H18Cl2O2 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | [2,4-dichloro-6-(2-phenylethenyl)-3-propan-2-ylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C=Cc2ccccc2)cc(Cl)c(C(C)C)c1Cl |
| InChI | InChI=1S/C19H18Cl2O2/c1-12(2)17-16(20)11-15(19(18(17)21)23-13(3)22)10-9-14-7-5-4-6-8-14/h4-12H,1-3H3 |
| InChIKey | NWYADLOXLUNMPE-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|