C38H46N4O10S — CID 174049165
4-[5-(4-carbamimidoylphenoxy)pentoxy]benzenecarboximidamide;1-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenylprop-2-en-1-one;2-hydroxyethanesulfonic acid (PubChem CID 174049165) has the molecular formula C38H46N4O10S and a molecular weight of 750.87 g/mol. Its IUPAC name is 4-[5-(4-carbamimidoylphenoxy)pentoxy]benzenecarboximidamide;1-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenylprop-2-en-1-one;2-hydroxyethanesulfonic acid.
| Compound Name | 4-[5-(4-carbamimidoylphenoxy)pentoxy]benzenecarboximidamide;1-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenylprop-2-en-1-one;2-hydroxyethanesulfonic acid |
|---|---|
| PubChem CID | 174049165 |
| Molecular Formula | C38H46N4O10S |
| Molecular Weight | 750.87 g/mol |
| Exact Mass | 750.29 |
| IUPAC Name | 4-[5-(4-carbamimidoylphenoxy)pentoxy]benzenecarboximidamide;1-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenylprop-2-en-1-one;2-hydroxyethanesulfonic acid |
| SMILES | COc1cc(O)c(C(=O)C=Cc2ccccc2)c(OC)c1.O=S(=O)(O)CCO.[H]/N=C(\N)c1ccc(OCCCCCOc2ccc(/C(N)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C19H24N4O2.C17H16O4.C2H6O4S/c20-18(21)14-4-8-16(9-5-14)24-12-2-1-3-13-25-17-10-6-15(7-11-17)19(22)23;1-20-13-10-15(19)17(16(11-13)21-2)14(18)9-8-12-6-4-3-5-7-12;3-1-2-7(4,5)6/h4-11H,1-3,12-13H2,(H3,20,21)(H3,22,23);3-11,19H,1-2H3;3H,1-2H2,(H,4,5,6) |
| InChIKey | IYFYPBZMOHCPQG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 248.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.87 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|